C18H24Cl6N2O2 — CID 154586037
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate;[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate (PubChem CID 154586037) has the molecular formula C18H24Cl6N2O2 and a molecular weight of 513.12 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate;[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate;[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 154586037 |
| Molecular Formula | C18H24Cl6N2O2 |
| Molecular Weight | 513.12 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate;[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1C[C@@H]2CC[C@H]1C2)C(Cl)(Cl)Cl.[H]/N=C(/O[C@H]1C[C@H]2CC[C@@H]1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/2C9H12Cl3NO/c2*10-9(11,12)8(13)14-7-4-5-1-2-6(7)3-5/h2*5-7,13H,1-4H2/b2*13-8+/t2*5-,6+,7-/m10/s1 |
| InChIKey | FQIZFQPQLLIJDY-HLOMQBMVSA-N |
| XLogP | 7.08 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.12 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|