C11H15O4- — CID 18389358
4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-oxobutanoate (PubChem CID 18389358) has the molecular formula C11H15O4- and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-oxobutanoate.
| Compound Name | 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 18389358 |
| Molecular Formula | C11H15O4- |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)O[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H16O4/c12-10(13)3-4-11(14)15-9-6-7-1-2-8(9)5-7/h7-9H,1-6H2,(H,12,13)/p-1/t7-,8+,9+/m0/s1 |
| InChIKey | JSLHQOQJMVNMBF-DJLDLDEBSA-M |
| XLogP | 0.25 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |