About 2-bicyclo[2.2.1]heptanyl nitrate
2-bicyclo[2.2.1]heptanyl nitrate (PubChem CID 12594107) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl nitrate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl nitrate |
| PubChem CID | 12594107 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl nitrate |
| SMILES | O=[N+]([O-])OC1CC2CCC1C2 |
| InChI | InChI=1S/C7H11NO3/c9-8(10)11-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2 |
| InChIKey | RNSXZTMMFHTFAT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]heptanyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl nitrate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl nitrate (CID 12594107) is 2-bicyclo[2.2.1]heptanyl nitrate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl nitrate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl nitrate is O=[N+]([O-])OC1CC2CCC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl nitrate?
The InChIKey is RNSXZTMMFHTFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c9-8(10)11-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2.
What are the key properties of 2-bicyclo[2.2.1]heptanyl nitrate?
2-bicyclo[2.2.1]heptanyl nitrate has a molecular weight of 157.17 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl nitrate is sourced from PubChem (CID 12594107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).