C8H12O2 — CID 98108160
[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl] formate (PubChem CID 98108160) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl] formate.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl] formate |
|---|---|
| PubChem CID | 98108160 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl] formate |
| SMILES | O=CO[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C8H12O2/c9-5-10-8-4-6-1-2-7(8)3-6/h5-8H,1-4H2/t6-,7-,8+/m1/s1 |
| InChIKey | SGXIEZNAOCVSKO-PRJMDXOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|