C16H26O6S2 — CID 89483111
bis(2-bicyclo[2.2.1]heptanyl) ethane-1,2-disulfonate (PubChem CID 89483111) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is bis(2-bicyclo[2.2.1]heptanyl) ethane-1,2-disulfonate.
| Compound Name | bis(2-bicyclo[2.2.1]heptanyl) ethane-1,2-disulfonate |
|---|---|
| PubChem CID | 89483111 |
| Molecular Formula | C16H26O6S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | bis(2-bicyclo[2.2.1]heptanyl) ethane-1,2-disulfonate |
| SMILES | O=S(=O)(CCS(=O)(=O)OC1CC2CCC1C2)OC1CC2CCC1C2 |
| InChI | InChI=1S/C16H26O6S2/c17-23(18,21-15-9-11-1-3-13(15)7-11)5-6-24(19,20)22-16-10-12-2-4-14(16)8-12/h11-16H,1-10H2 |
| InChIKey | VHPMZRGFRIQUOS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|