C10H15F3O4S — CID 129061581
2-(2-bicyclo[2.2.1]heptanyloxy)-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061581) has the molecular formula C10H15F3O4S and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyloxy)-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyloxy)-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061581 |
| Molecular Formula | C10H15F3O4S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyloxy)-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(OC1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O4S/c11-10(12,13)9(5-18(14,15)16)17-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2,(H,14,15,16) |
| InChIKey | PMCFPDVTBUWTOL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|