C12H15F5O6S — CID 58091845
2-[2-(2-bicyclo[2.2.1]heptanyloxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 58091845) has the molecular formula C12H15F5O6S and a molecular weight of 382.30 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanyloxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanyloxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58091845 |
| Molecular Formula | C12H15F5O6S |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanyloxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(COC1CC2CCC1C2)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H15F5O6S/c13-11(14,15)10(12(16,17)24(19,20)21)23-9(18)5-22-8-4-6-1-2-7(8)3-6/h6-8,10H,1-5H2,(H,19,20,21) |
| InChIKey | QBDBWRDPGZPFIX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|