C14H22F2O8S — CID 166896000
1,1-difluoro-2-hydroxy-2-[2-[2-[(1-hydroxycyclopentyl)methyl]cyclobutyl]oxyacetyl]oxyethanesulfonic acid (PubChem CID 166896000) has the molecular formula C14H22F2O8S and a molecular weight of 388.39 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-[2-[2-[(1-hydroxycyclopentyl)methyl]cyclobutyl]oxyacetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-hydroxy-2-[2-[2-[(1-hydroxycyclopentyl)methyl]cyclobutyl]oxyacetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166896000 |
| Molecular Formula | C14H22F2O8S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-[2-[2-[(1-hydroxycyclopentyl)methyl]cyclobutyl]oxyacetyl]oxyethanesulfonic acid |
| SMILES | O=C(COC1CCC1CC1(O)CCCC1)OC(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H22F2O8S/c15-14(16,25(20,21)22)12(18)24-11(17)8-23-10-4-3-9(10)7-13(19)5-1-2-6-13/h9-10,12,18-19H,1-8H2,(H,20,21,22) |
| InChIKey | BBYNHXVCMZNSSM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|