C17H26F2O7S — CID 163658424
2-[2,3-bis(1-hydroxycyclopentyl)cyclopropanecarbonyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 163658424) has the molecular formula C17H26F2O7S and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[2,3-bis(1-hydroxycyclopentyl)cyclopropanecarbonyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[2,3-bis(1-hydroxycyclopentyl)cyclopropanecarbonyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 163658424 |
| Molecular Formula | C17H26F2O7S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2,3-bis(1-hydroxycyclopentyl)cyclopropanecarbonyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)C1C(C2(O)CCCC2)C1C1(O)CCCC1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H26F2O7S/c1-10(17(18,19)27(23,24)25)26-14(20)11-12(15(21)6-2-3-7-15)13(11)16(22)8-4-5-9-16/h10-13,21-22H,2-9H2,1H3,(H,23,24,25) |
| InChIKey | PRYMXRMGBSAUGG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|