C14H20F2O5S — CID 58133236
2-(adamantane-1-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid (PubChem CID 58133236) has the molecular formula C14H20F2O5S and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58133236 |
| Molecular Formula | C14H20F2O5S |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H20F2O5S/c1-8(14(15,16)22(18,19)20)21-12(17)13-5-9-2-10(6-13)4-11(3-9)7-13/h8-11H,2-7H2,1H3,(H,18,19,20) |
| InChIKey | LCGZTXDMKLJKSC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|