C28H38F4O7S — CID 89285717
5,6-bis(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonic acid (PubChem CID 89285717) has the molecular formula C28H38F4O7S and a molecular weight of 594.66 g/mol. Its IUPAC name is 5,6-bis(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonic acid.
| Compound Name | 5,6-bis(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 89285717 |
| Molecular Formula | C28H38F4O7S |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 5,6-bis(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorohexane-1-sulfonic acid |
| SMILES | O=C(OCC(CCC(F)(F)C(F)(F)S(=O)(=O)O)OC(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H38F4O7S/c29-27(30,28(31,32)40(35,36)37)2-1-22(39-24(34)26-12-19-6-20(13-26)8-21(7-19)14-26)15-38-23(33)25-9-16-3-17(10-25)5-18(4-16)11-25/h16-22H,1-15H2,(H,35,36,37) |
| InChIKey | VCNUNLHBNLEJSU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|