C15H19F5O5S — CID 118861847
3-(adamantane-1-carbonyloxy)-2,2,4,4,4-pentafluorobutane-1-sulfonic acid (PubChem CID 118861847) has the molecular formula C15H19F5O5S and a molecular weight of 406.37 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-2,2,4,4,4-pentafluorobutane-1-sulfonic acid.
| Compound Name | 3-(adamantane-1-carbonyloxy)-2,2,4,4,4-pentafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 118861847 |
| Molecular Formula | C15H19F5O5S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-2,2,4,4,4-pentafluorobutane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)CS(=O)(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H19F5O5S/c16-14(17,7-26(22,23)24)11(15(18,19)20)25-12(21)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-11H,1-7H2,(H,22,23,24) |
| InChIKey | WTFVITRCJLOSTO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|