C14H18F3O5S- — CID 58283188
2-(adamantane-1-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonate (PubChem CID 58283188) has the molecular formula C14H18F3O5S- and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonate.
| Compound Name | 2-(adamantane-1-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58283188 |
| Molecular Formula | C14H18F3O5S- |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonate |
| SMILES | O=C(OC(CS(=O)(=O)[O-])C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H19F3O5S/c15-14(16,17)11(7-23(19,20)21)22-12(18)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-11H,1-7H2,(H,19,20,21)/p-1 |
| InChIKey | RXVAHJMRMJXSQP-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|