C15H19F2NaO7S — CID 164579752
sodium 2-[2-(adamantane-1-carbonyloxy)ethoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 164579752) has the molecular formula C15H19F2NaO7S and a molecular weight of 404.36 g/mol. Its IUPAC name is sodium 2-[2-(adamantane-1-carbonyloxy)ethoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | sodium 2-[2-(adamantane-1-carbonyloxy)ethoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 164579752 |
| Molecular Formula | C15H19F2NaO7S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | sodium 2-[2-(adamantane-1-carbonyloxy)ethoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(OCCOC(=O)C(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C15H20F2O7S.Na/c16-15(17,25(20,21)22)13(19)24-2-1-23-12(18)14-6-9-3-10(7-14)5-11(4-9)8-14;/h9-11H,1-8H2,(H,20,21,22);/q;+1/p-1 |
| InChIKey | HCJXAKBTGOAFBJ-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|