C17H22F6O3 — CID 89280247
2-(1,1,2,2,3,3-hexafluorobutoxy)ethyl adamantane-1-carboxylate (PubChem CID 89280247) has the molecular formula C17H22F6O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexafluorobutoxy)ethyl adamantane-1-carboxylate.
| Compound Name | 2-(1,1,2,2,3,3-hexafluorobutoxy)ethyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89280247 |
| Molecular Formula | C17H22F6O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexafluorobutoxy)ethyl adamantane-1-carboxylate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)OCCOC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22F6O3/c1-14(18,19)16(20,21)17(22,23)26-3-2-25-13(24)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,2-9H2,1H3 |
| InChIKey | HVACAMABVZKRKT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|