C13H17BrF2O2 — CID 59185161
(2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate (PubChem CID 59185161) has the molecular formula C13H17BrF2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is (2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate.
| Compound Name | (2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 59185161 |
| Molecular Formula | C13H17BrF2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)Br)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H17BrF2O2/c14-13(15,16)7-18-11(17)12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2 |
| InChIKey | OAEOZTNXVYVTHY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|