C25H32O8 — CID 18757373
[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] adamantane-1-carboxylate (PubChem CID 18757373) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] adamantane-1-carboxylate.
| Compound Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 18757373 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] adamantane-1-carboxylate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32O8/c1-4-20(26)30-13-24(14-31-21(27)5-2,15-32-22(28)6-3)16-33-23(29)25-10-17-7-18(11-25)9-19(8-17)12-25/h4-6,17-19H,1-3,7-16H2 |
| InChIKey | UNMJOCGVQBWDEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|