C37H52O8 — CID 90912106
[2-[(3,5-dimethyladamantane-1-carbonyl)oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3,5-dimethyladamantane-1-carboxylate (PubChem CID 90912106) has the molecular formula C37H52O8 and a molecular weight of 624.82 g/mol. Its IUPAC name is [2-[(3,5-dimethyladamantane-1-carbonyl)oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3,5-dimethyladamantane-1-carboxylate.
| Compound Name | [2-[(3,5-dimethyladamantane-1-carbonyl)oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3,5-dimethyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 90912106 |
| Molecular Formula | C37H52O8 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | [2-[(3,5-dimethyladamantane-1-carbonyl)oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3,5-dimethyladamantane-1-carboxylate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2)COC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C37H52O8/c1-7-27(38)42-21-35(22-43-28(39)8-2,23-44-29(40)36-13-25-9-31(3,17-36)15-32(4,10-25)18-36)24-45-30(41)37-14-26-11-33(5,19-37)16-34(6,12-26)20-37/h7-8,25-26H,1-2,9-24H2,3-6H3 |
| InChIKey | VVZXUVPDAJEHIH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|