C31H41BrF4O6 — CID 90264182
[2-(adamantane-1-carbonyloxymethyl)-3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxopropyl] adamantane-1-carboxylate (PubChem CID 90264182) has the molecular formula C31H41BrF4O6 and a molecular weight of 665.56 g/mol. Its IUPAC name is [2-(adamantane-1-carbonyloxymethyl)-3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxopropyl] adamantane-1-carboxylate.
| Compound Name | [2-(adamantane-1-carbonyloxymethyl)-3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxopropyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 90264182 |
| Molecular Formula | C31H41BrF4O6 |
| Molecular Weight | 665.56 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | [2-(adamantane-1-carbonyloxymethyl)-3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxopropyl] adamantane-1-carboxylate |
| SMILES | CC(COC(=O)C12CC3CC(CC(C3)C1)C2)(COC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)OCCC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C31H41BrF4O6/c1-27(24(37)40-3-2-30(33,34)31(32,35)36,16-41-25(38)28-10-18-4-19(11-28)6-20(5-18)12-28)17-42-26(39)29-13-21-7-22(14-29)9-23(8-21)15-29/h18-23H,2-17H2,1H3 |
| InChIKey | WPSHOWLOXUCPDO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|