C25H37BrF4O10 — CID 90264189
[3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxo-2-[(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxymethyl]propyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate (PubChem CID 90264189) has the molecular formula C25H37BrF4O10 and a molecular weight of 653.46 g/mol. Its IUPAC name is [3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxo-2-[(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxymethyl]propyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate.
| Compound Name | [3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxo-2-[(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxymethyl]propyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 90264189 |
| Molecular Formula | C25H37BrF4O10 |
| Molecular Weight | 653.46 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | [3-(4-bromo-3,3,4,4-tetrafluorobutoxy)-2-methyl-3-oxo-2-[(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)oxymethyl]propyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C)OCC(C)(C(=O)OCC(C)(COC(=O)C2(C)COC(C)(C)OC2)C(=O)OCCC(F)(F)C(F)(F)Br)CO1 |
| InChI | InChI=1S/C25H37BrF4O10/c1-19(2)37-12-22(6,13-38-19)17(32)35-10-21(5,16(31)34-9-8-24(27,28)25(26,29)30)11-36-18(33)23(7)14-39-20(3,4)40-15-23/h8-15H2,1-7H3 |
| InChIKey | PXGVQNIDIAMPCG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|