C12H17BrF4O4 — CID 90255544
4-(4-bromo-3,3,4,4-tetrafluorobutyl)-2,2,5-trimethyl-1,3-dioxane-5-carboxylic acid (PubChem CID 90255544) has the molecular formula C12H17BrF4O4 and a molecular weight of 381.16 g/mol. Its IUPAC name is 4-(4-bromo-3,3,4,4-tetrafluorobutyl)-2,2,5-trimethyl-1,3-dioxane-5-carboxylic acid.
| Compound Name | 4-(4-bromo-3,3,4,4-tetrafluorobutyl)-2,2,5-trimethyl-1,3-dioxane-5-carboxylic acid |
|---|---|
| PubChem CID | 90255544 |
| Molecular Formula | C12H17BrF4O4 |
| Molecular Weight | 381.16 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 4-(4-bromo-3,3,4,4-tetrafluorobutyl)-2,2,5-trimethyl-1,3-dioxane-5-carboxylic acid |
| SMILES | CC1(C)OCC(C)(C(=O)O)C(CCC(F)(F)C(F)(F)Br)O1 |
| InChI | InChI=1S/C12H17BrF4O4/c1-9(2)20-6-10(3,8(18)19)7(21-9)4-5-11(14,15)12(13,16)17/h7H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | GWEOAWRCVXKIAC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|