C16H19F7NO6S2- — CID 58100558
[4-(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorobutyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 58100558) has the molecular formula C16H19F7NO6S2- and a molecular weight of 518.45 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorobutyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorobutyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 58100558 |
| Molecular Formula | C16H19F7NO6S2- |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | [4-(adamantane-1-carbonyloxy)-1,1,2,2-tetrafluorobutyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H19F7NO6S2/c17-14(18,15(19,20)31(26,27)24-32(28,29)16(21,22)23)1-2-30-12(25)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,1-8H2/q-1 |
| InChIKey | UUUGCPXSKJVTBD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|