C20H27F4O6S- — CID 162503954
1,1,2,2-tetrafluoro-4-[3-(1-hydroxycyclopentyl)adamantane-1-carbonyl]oxybutane-1-sulfonate (PubChem CID 162503954) has the molecular formula C20H27F4O6S- and a molecular weight of 471.49 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[3-(1-hydroxycyclopentyl)adamantane-1-carbonyl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[3-(1-hydroxycyclopentyl)adamantane-1-carbonyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 162503954 |
| Molecular Formula | C20H27F4O6S- |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[3-(1-hydroxycyclopentyl)adamantane-1-carbonyl]oxybutane-1-sulfonate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C12CC3CC(C1)CC(C1(O)CCCC1)(C3)C2 |
| InChI | InChI=1S/C20H28F4O6S/c21-19(22,20(23,24)31(27,28)29)5-6-30-15(25)16-8-13-7-14(9-16)11-17(10-13,12-16)18(26)3-1-2-4-18/h13-14,26H,1-12H2,(H,27,28,29)/p-1 |
| InChIKey | KFFWBZKSKIDMEV-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|