C29H35F4NaO10S — CID 140667882
sodium 1,1,2,2-tetrafluoro-4-[3-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)acetyl]oxyadamantane-1-carbonyl]oxybutane-1-sulfonate (PubChem CID 140667882) has the molecular formula C29H35F4NaO10S and a molecular weight of 674.64 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-4-[3-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)acetyl]oxyadamantane-1-carbonyl]oxybutane-1-sulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluoro-4-[3-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)acetyl]oxyadamantane-1-carbonyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 140667882 |
| Molecular Formula | C29H35F4NaO10S |
| Molecular Weight | 674.64 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoro-4-[3-[2-(5-oxospiro[1,3-dioxolane-2,2'-adamantane]-4-yl)acetyl]oxyadamantane-1-carbonyl]oxybutane-1-sulfonate |
| SMILES | O=C(CC1OC2(OC1=O)C1CC3CC(C1)CC2C3)OC12CC3CC(C1)CC(C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C3)C2.[Na+] |
| InChI | InChI=1S/C29H36F4O10S.Na/c30-27(31,29(32,33)44(37,38)39)1-2-40-24(36)25-10-17-4-18(11-25)13-26(12-17,14-25)42-22(34)9-21-23(35)43-28(41-21)19-5-15-3-16(7-19)8-20(28)6-15;/h15-21H,1-14H2,(H,37,38,39);/q;+1/p-1 |
| InChIKey | PZLXTCJCJULKPT-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 145.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.64 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|