C20H27F3O9S — CID 166874372
5-oxo-5-[[3-(4,4,4-trifluoro-3-sulfobutoxy)carbonyl-1-adamantyl]oxy]pentanoic acid (PubChem CID 166874372) has the molecular formula C20H27F3O9S and a molecular weight of 500.49 g/mol. Its IUPAC name is 5-oxo-5-[[3-(4,4,4-trifluoro-3-sulfobutoxy)carbonyl-1-adamantyl]oxy]pentanoic acid.
| Compound Name | 5-oxo-5-[[3-(4,4,4-trifluoro-3-sulfobutoxy)carbonyl-1-adamantyl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 166874372 |
| Molecular Formula | C20H27F3O9S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 5-oxo-5-[[3-(4,4,4-trifluoro-3-sulfobutoxy)carbonyl-1-adamantyl]oxy]pentanoic acid |
| SMILES | O=C(O)CCCC(=O)OC12CC3CC(C1)CC(C(=O)OCCC(C(F)(F)F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C20H27F3O9S/c21-20(22,23)14(33(28,29)30)4-5-31-17(27)18-7-12-6-13(8-18)10-19(9-12,11-18)32-16(26)3-1-2-15(24)25/h12-14H,1-11H2,(H,24,25)(H,28,29,30) |
| InChIKey | YPOPDECOPBPFIF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|