C21H21Br3O6 — CID 159417260
3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid (PubChem CID 159417260) has the molecular formula C21H21Br3O6 and a molecular weight of 609.11 g/mol. Its IUPAC name is 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid.
| Compound Name | 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid |
|---|---|
| PubChem CID | 159417260 |
| Molecular Formula | C21H21Br3O6 |
| Molecular Weight | 609.11 g/mol |
| Exact Mass | 605.89 |
| IUPAC Name | 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid |
| SMILES | O=C(O)CCOC(=O)C12CC3CC(CC(OC(=O)c4cc(Br)cc(Br)c4Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H21Br3O6/c22-13-4-14(17(24)15(23)5-13)18(27)30-21-8-11-3-12(9-21)7-20(6-11,10-21)19(28)29-2-1-16(25)26/h4-5,11-12H,1-3,6-10H2,(H,25,26) |
| InChIKey | QDHMQIPWIYTHON-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.11 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|