About 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid
3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid (PubChem CID 159417260) has the molecular formula C21H21Br3O6
and a molecular weight of 609.11 g/mol. Its IUPAC name is 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid |
| PubChem CID | 159417260 |
| Molecular Formula | C21H21Br3O6 |
| Molecular Weight | 609.11 g/mol |
| Exact Mass | 605.89 |
| IUPAC Name | 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid |
| SMILES | O=C(O)CCOC(=O)C12CC3CC(CC(OC(=O)c4cc(Br)cc(Br)c4Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H21Br3O6/c22-13-4-14(17(24)15(23)5-13)18(27)30-21-8-11-3-12(9-21)7-20(6-11,10-21)19(28)29-2-1-16(25)26/h4-5,11-12H,1-3,6-10H2,(H,25,26) |
| InChIKey | QDHMQIPWIYTHON-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.11 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid?
The IUPAC name of 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid (CID 159417260) is 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid.
What is the SMILES notation for 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid?
The canonical SMILES for 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid is O=C(O)CCOC(=O)C12CC3CC(CC(OC(=O)c4cc(Br)cc(Br)c4Br)(C3)C1)C2.
What is the InChIKey of 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid?
The InChIKey is QDHMQIPWIYTHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Br3O6/c22-13-4-14(17(24)15(23)5-13)18(27)30-21-8-11-3-12(9-21)7-20(6-11,10-21)19(28)29-2-1-16(25)26/h4-5,11-12H,1-3,6-10H2,(H,25,26).
What are the key properties of 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid?
3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid has a molecular weight of 609.11 g/mol, XLogP of 5.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carbonyl]oxypropanoic acid is sourced from PubChem (CID 159417260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).