C18H16Br3O4- — CID 154611966
3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carboxylate (PubChem CID 154611966) has the molecular formula C18H16Br3O4- and a molecular weight of 536.03 g/mol. Its IUPAC name is 3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carboxylate.
| Compound Name | 3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 154611966 |
| Molecular Formula | C18H16Br3O4- |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 532.86 |
| IUPAC Name | 3-(2,3,5-tribromobenzoyl)oxyadamantane-1-carboxylate |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)[O-])(C3)C2)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C18H17Br3O4/c19-11-2-12(14(21)13(20)3-11)15(22)25-18-6-9-1-10(7-18)5-17(4-9,8-18)16(23)24/h2-3,9-10H,1,4-8H2,(H,23,24)/p-1 |
| InChIKey | GAGWNXGVPWHKNP-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|