C17H16I3O5S- — CID 153471770
3-(2,3,5-triiodobenzoyl)oxyadamantane-1-sulfonate (PubChem CID 153471770) has the molecular formula C17H16I3O5S- and a molecular weight of 713.09 g/mol. Its IUPAC name is 3-(2,3,5-triiodobenzoyl)oxyadamantane-1-sulfonate.
| Compound Name | 3-(2,3,5-triiodobenzoyl)oxyadamantane-1-sulfonate |
|---|---|
| PubChem CID | 153471770 |
| Molecular Formula | C17H16I3O5S- |
| Molecular Weight | 713.09 g/mol |
| Exact Mass | 712.79 |
| IUPAC Name | 3-(2,3,5-triiodobenzoyl)oxyadamantane-1-sulfonate |
| SMILES | O=C(OC12CC3CC(C1)CC(S(=O)(=O)[O-])(C3)C2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C17H17I3O5S/c18-11-2-12(14(20)13(19)3-11)15(21)25-16-4-9-1-10(5-16)7-17(6-9,8-16)26(22,23)24/h2-3,9-10H,1,4-8H2,(H,22,23,24)/p-1 |
| InChIKey | HJZWJAMCNCCEGB-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.09 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|