C34H37I3O7S — CID 170531376
2-(2-bicyclo[2.2.1]heptanyl)-6-propan-2-yl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid (PubChem CID 170531376) has the molecular formula C34H37I3O7S and a molecular weight of 970.44 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-6-propan-2-yl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-6-propan-2-yl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531376 |
| Molecular Formula | C34H37I3O7S |
| Molecular Weight | 970.44 g/mol |
| Exact Mass | 969.94 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-6-propan-2-yl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid |
| SMILES | CC(C)c1cc(OC(=O)C23CC4CC(CC(OC(=O)c5cc(I)cc(I)c5I)(C4)C2)C3)cc(C2CC3CCC2C3)c1S(=O)(=O)O |
| InChI | InChI=1S/C34H37I3O7S/c1-17(2)24-10-23(11-26(30(24)45(40,41)42)25-7-18-3-4-21(25)6-18)43-32(39)33-12-19-5-20(13-33)15-34(14-19,16-33)44-31(38)27-8-22(35)9-28(36)29(27)37/h8-11,17-21,25H,3-7,12-16H2,1-2H3,(H,40,41,42) |
| InChIKey | KNJKYYLERZRALG-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.44 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|