C27H10I8O9S — CID 177131906
4-[3,5-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-2,6-diiodobenzenesulfonic acid (PubChem CID 177131906) has the molecular formula C27H10I8O9S and a molecular weight of 1525.67 g/mol. Its IUPAC name is 4-[3,5-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-2,6-diiodobenzenesulfonic acid.
| Compound Name | 4-[3,5-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-2,6-diiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131906 |
| Molecular Formula | C27H10I8O9S |
| Molecular Weight | 1525.67 g/mol |
| Exact Mass | 1525.24 |
| IUPAC Name | 4-[3,5-bis[(2,3,5-triiodobenzoyl)oxy]benzoyl]oxy-2,6-diiodobenzenesulfonic acid |
| SMILES | O=C(Oc1cc(I)c(S(=O)(=O)O)c(I)c1)c1cc(OC(=O)c2cc(I)cc(I)c2I)cc(OC(=O)c2cc(I)cc(I)c2I)c1 |
| InChI | InChI=1S/C27H10I8O9S/c28-11-3-16(22(34)18(30)5-11)26(37)43-13-1-10(25(36)42-15-8-20(32)24(21(33)9-15)45(39,40)41)2-14(7-13)44-27(38)17-4-12(29)6-19(31)23(17)35/h1-9H,(H,39,40,41) |
| InChIKey | MHFRQRSXMPQPBH-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1525.67 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|