C14H6F3I3NO4S- — CID 162466853
trifluoromethylsulfonyl-[4-(2,3,5-triiodobenzoyl)oxyphenyl]azanide (PubChem CID 162466853) has the molecular formula C14H6F3I3NO4S- and a molecular weight of 721.98 g/mol. Its IUPAC name is trifluoromethylsulfonyl-[4-(2,3,5-triiodobenzoyl)oxyphenyl]azanide.
| Compound Name | trifluoromethylsulfonyl-[4-(2,3,5-triiodobenzoyl)oxyphenyl]azanide |
|---|---|
| PubChem CID | 162466853 |
| Molecular Formula | C14H6F3I3NO4S- |
| Molecular Weight | 721.98 g/mol |
| Exact Mass | 721.71 |
| IUPAC Name | trifluoromethylsulfonyl-[4-(2,3,5-triiodobenzoyl)oxyphenyl]azanide |
| SMILES | O=C(Oc1ccc([N-]S(=O)(=O)C(F)(F)F)cc1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H6F3I3NO4S/c15-14(16,17)26(23,24)21-8-1-3-9(4-2-8)25-13(22)10-5-7(18)6-11(19)12(10)20/h1-6H/q-1 |
| InChIKey | FNCSBSVMQUGIPW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.98 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|