C10H7F3I3N2O3S- — CID 162771697
trifluoromethylsulfonyl-[2-[(2,3,5-triiodobenzoyl)amino]ethyl]azanide (PubChem CID 162771697) has the molecular formula C10H7F3I3N2O3S- and a molecular weight of 672.95 g/mol. Its IUPAC name is trifluoromethylsulfonyl-[2-[(2,3,5-triiodobenzoyl)amino]ethyl]azanide.
| Compound Name | trifluoromethylsulfonyl-[2-[(2,3,5-triiodobenzoyl)amino]ethyl]azanide |
|---|---|
| PubChem CID | 162771697 |
| Molecular Formula | C10H7F3I3N2O3S- |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.73 |
| IUPAC Name | trifluoromethylsulfonyl-[2-[(2,3,5-triiodobenzoyl)amino]ethyl]azanide |
| SMILES | O=C(NCC[N-]S(=O)(=O)C(F)(F)F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H7F3I3N2O3S/c11-10(12,13)22(20,21)18-2-1-17-9(19)6-3-5(14)4-7(15)8(6)16/h3-4H,1-2H2,(H,17,19)/q-1 |
| InChIKey | GLIJLEKZOJAUOK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|