C16H19FI3NO3 — CID 159107261
1-fluoroethyl 7-[(2,3,5-triiodobenzoyl)amino]heptanoate (PubChem CID 159107261) has the molecular formula C16H19FI3NO3 and a molecular weight of 673.04 g/mol. Its IUPAC name is 1-fluoroethyl 7-[(2,3,5-triiodobenzoyl)amino]heptanoate.
| Compound Name | 1-fluoroethyl 7-[(2,3,5-triiodobenzoyl)amino]heptanoate |
|---|---|
| PubChem CID | 159107261 |
| Molecular Formula | C16H19FI3NO3 |
| Molecular Weight | 673.04 g/mol |
| Exact Mass | 672.85 |
| IUPAC Name | 1-fluoroethyl 7-[(2,3,5-triiodobenzoyl)amino]heptanoate |
| SMILES | CC(F)OC(=O)CCCCCCNC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H19FI3NO3/c1-10(17)24-14(22)6-4-2-3-5-7-21-16(23)12-8-11(18)9-13(19)15(12)20/h8-10H,2-7H2,1H3,(H,21,23) |
| InChIKey | VSVIRWGPUQWTEG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.04 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|