C14H13F2I3NO5S- — CID 164728151
1,1-difluoro-2-oxo-7-[(2,3,5-triiodobenzoyl)amino]heptane-1-sulfonate (PubChem CID 164728151) has the molecular formula C14H13F2I3NO5S- and a molecular weight of 726.03 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-7-[(2,3,5-triiodobenzoyl)amino]heptane-1-sulfonate.
| Compound Name | 1,1-difluoro-2-oxo-7-[(2,3,5-triiodobenzoyl)amino]heptane-1-sulfonate |
|---|---|
| PubChem CID | 164728151 |
| Molecular Formula | C14H13F2I3NO5S- |
| Molecular Weight | 726.03 g/mol |
| Exact Mass | 725.76 |
| IUPAC Name | 1,1-difluoro-2-oxo-7-[(2,3,5-triiodobenzoyl)amino]heptane-1-sulfonate |
| SMILES | O=C(NCCCCCC(=O)C(F)(F)S(=O)(=O)[O-])c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H14F2I3NO5S/c15-14(16,26(23,24)25)11(21)4-2-1-3-5-20-13(22)9-6-8(17)7-10(18)12(9)19/h6-7H,1-5H2,(H,20,22)(H,23,24,25)/p-1 |
| InChIKey | BGMVLBQZYKZTJL-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.03 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|