C12H12I3NO6S — CID 146530725
2-[2-[(2,3,5-triiodobenzoyl)amino]propanoyloxy]ethanesulfonic acid (PubChem CID 146530725) has the molecular formula C12H12I3NO6S and a molecular weight of 679.01 g/mol. Its IUPAC name is 2-[2-[(2,3,5-triiodobenzoyl)amino]propanoyloxy]ethanesulfonic acid.
| Compound Name | 2-[2-[(2,3,5-triiodobenzoyl)amino]propanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 146530725 |
| Molecular Formula | C12H12I3NO6S |
| Molecular Weight | 679.01 g/mol |
| Exact Mass | 678.75 |
| IUPAC Name | 2-[2-[(2,3,5-triiodobenzoyl)amino]propanoyloxy]ethanesulfonic acid |
| SMILES | CC(NC(=O)c1cc(I)cc(I)c1I)C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C12H12I3NO6S/c1-6(12(18)22-2-3-23(19,20)21)16-11(17)8-4-7(13)5-9(14)10(8)15/h4-6H,2-3H2,1H3,(H,16,17)(H,19,20,21) |
| InChIKey | DXWANICEBOLRHI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.01 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|