C16H10I3NO9S — CID 167569413
2-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid (PubChem CID 167569413) has the molecular formula C16H10I3NO9S and a molecular weight of 773.03 g/mol. Its IUPAC name is 2-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 167569413 |
| Molecular Formula | C16H10I3NO9S |
| Molecular Weight | 773.03 g/mol |
| Exact Mass | 772.72 |
| IUPAC Name | 2-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid |
| SMILES | O=C(OCCS(=O)(=O)O)c1ccc(OC(=O)c2cc(I)cc(I)c2I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10I3NO9S/c17-8-5-11(14(19)12(18)6-8)16(22)29-9-1-2-10(13(7-9)20(23)24)15(21)28-3-4-30(25,26)27/h1-2,5-7H,3-4H2,(H,25,26,27) |
| InChIKey | JDIYEWWIOPANKW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.03 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|