C27H22F2I3NO11S — CID 166044245
1,1-difluoro-2-[3-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 166044245) has the molecular formula C27H22F2I3NO11S and a molecular weight of 987.24 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166044245 |
| Molecular Formula | C27H22F2I3NO11S |
| Molecular Weight | 987.24 g/mol |
| Exact Mass | 986.80 |
| IUPAC Name | 1,1-difluoro-2-[3-[2-nitro-4-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyadamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2)c1ccc(OC(=O)c2cc(I)cc(I)c2I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H22F2I3NO11S/c28-27(29,45(39,40)41)12-42-24(36)25-7-13-3-14(8-25)10-26(9-13,11-25)44-23(35)17-2-1-16(6-20(17)33(37)38)43-22(34)18-4-15(30)5-19(31)21(18)32/h1-2,4-6,13-14H,3,7-12H2,(H,39,40,41) |
| InChIKey | OEYUTKCEAIHVQH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 176.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.24 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|