C36H29I3O7S — CID 170531093
2,6-diphenyl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid (PubChem CID 170531093) has the molecular formula C36H29I3O7S and a molecular weight of 986.40 g/mol. Its IUPAC name is 2,6-diphenyl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2,6-diphenyl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531093 |
| Molecular Formula | C36H29I3O7S |
| Molecular Weight | 986.40 g/mol |
| Exact Mass | 985.88 |
| IUPAC Name | 2,6-diphenyl-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonic acid |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)Oc1cc(-c4ccccc4)c(S(=O)(=O)O)c(-c4ccccc4)c1)(C3)C2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C36H29I3O7S/c37-25-12-29(31(39)30(38)13-25)33(40)46-36-18-21-11-22(19-36)17-35(16-21,20-36)34(41)45-26-14-27(23-7-3-1-4-8-23)32(47(42,43)44)28(15-26)24-9-5-2-6-10-24/h1-10,12-15,21-22H,11,16-20H2,(H,42,43,44) |
| InChIKey | JWQDYCZVSVREOA-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.40 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|