C16H11I3O7S — CID 159497197
2-[3-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid (PubChem CID 159497197) has the molecular formula C16H11I3O7S and a molecular weight of 728.04 g/mol. Its IUPAC name is 2-[3-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 159497197 |
| Molecular Formula | C16H11I3O7S |
| Molecular Weight | 728.04 g/mol |
| Exact Mass | 727.74 |
| IUPAC Name | 2-[3-(2,3,5-triiodobenzoyl)oxybenzoyl]oxyethanesulfonic acid |
| SMILES | O=C(OCCS(=O)(=O)O)c1cccc(OC(=O)c2cc(I)cc(I)c2I)c1 |
| InChI | InChI=1S/C16H11I3O7S/c17-10-7-12(14(19)13(18)8-10)16(21)26-11-3-1-2-9(6-11)15(20)25-4-5-27(22,23)24/h1-3,6-8H,4-5H2,(H,22,23,24) |
| InChIKey | JXECEHKKBSOJTF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.04 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|