C12H16O7S — CID 88818077
3-[3-(2-hydroxyethoxycarbonyl)phenoxy]propane-1-sulfonic acid (PubChem CID 88818077) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethoxycarbonyl)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[3-(2-hydroxyethoxycarbonyl)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88818077 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[3-(2-hydroxyethoxycarbonyl)phenoxy]propane-1-sulfonic acid |
| SMILES | O=C(OCCO)c1cccc(OCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H16O7S/c13-5-7-19-12(14)10-3-1-4-11(9-10)18-6-2-8-20(15,16)17/h1,3-4,9,13H,2,5-8H2,(H,15,16,17) |
| InChIKey | BFCYXTRNUJITFC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|