C16H9I3NO9S- — CID 176596861
3-nitro-4-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzenesulfonate (PubChem CID 176596861) has the molecular formula C16H9I3NO9S- and a molecular weight of 772.02 g/mol. Its IUPAC name is 3-nitro-4-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzenesulfonate.
| Compound Name | 3-nitro-4-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 176596861 |
| Molecular Formula | C16H9I3NO9S- |
| Molecular Weight | 772.02 g/mol |
| Exact Mass | 771.71 |
| IUPAC Name | 3-nitro-4-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzenesulfonate |
| SMILES | O=C(OCCOC(=O)c1cc(I)cc(I)c1I)c1ccc(S(=O)(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10I3NO9S/c17-8-5-11(14(19)12(18)6-8)16(22)29-4-3-28-15(21)10-2-1-9(30(25,26)27)7-13(10)20(23)24/h1-2,5-7H,3-4H2,(H,25,26,27)/p-1 |
| InChIKey | KKRRSUSSBYWGFI-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 152.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.02 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|