C11H11I3NO2+ — CID 152918114
ethenyl-[2-(2,3,5-triiodobenzoyl)oxyethyl]azanium (PubChem CID 152918114) has the molecular formula C11H11I3NO2+ and a molecular weight of 569.93 g/mol. Its IUPAC name is ethenyl-[2-(2,3,5-triiodobenzoyl)oxyethyl]azanium.
| Compound Name | ethenyl-[2-(2,3,5-triiodobenzoyl)oxyethyl]azanium |
|---|---|
| PubChem CID | 152918114 |
| Molecular Formula | C11H11I3NO2+ |
| Molecular Weight | 569.93 g/mol |
| Exact Mass | 569.79 |
| IUPAC Name | ethenyl-[2-(2,3,5-triiodobenzoyl)oxyethyl]azanium |
| SMILES | C=C[NH2+]CCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C11H10I3NO2/c1-2-15-3-4-17-11(16)8-5-7(12)6-9(13)10(8)14/h2,5-6,15H,1,3-4H2/p+1 |
| InChIKey | UINIFJHSMYJWIN-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|