C10H10I3NO2 — CID 146366052
2-(methylamino)ethyl 2,3,5-triiodobenzoate (PubChem CID 146366052) has the molecular formula C10H10I3NO2 and a molecular weight of 556.91 g/mol. Its IUPAC name is 2-(methylamino)ethyl 2,3,5-triiodobenzoate.
| Compound Name | 2-(methylamino)ethyl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 146366052 |
| Molecular Formula | C10H10I3NO2 |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.78 |
| IUPAC Name | 2-(methylamino)ethyl 2,3,5-triiodobenzoate |
| SMILES | CNCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H10I3NO2/c1-14-2-3-16-10(15)7-4-6(11)5-8(12)9(7)13/h4-5,14H,2-3H2,1H3 |
| InChIKey | JGBJGQCLHUGBKW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|