C13H13I3NO5S- — CID 153287505
(1E)-N-methylsulfonyl-5-(2,3,5-triiodobenzoyl)oxypentanimidate (PubChem CID 153287505) has the molecular formula C13H13I3NO5S- and a molecular weight of 676.03 g/mol. Its IUPAC name is (1E)-N-methylsulfonyl-5-(2,3,5-triiodobenzoyl)oxypentanimidate.
| Compound Name | (1E)-N-methylsulfonyl-5-(2,3,5-triiodobenzoyl)oxypentanimidate |
|---|---|
| PubChem CID | 153287505 |
| Molecular Formula | C13H13I3NO5S- |
| Molecular Weight | 676.03 g/mol |
| Exact Mass | 675.77 |
| IUPAC Name | (1E)-N-methylsulfonyl-5-(2,3,5-triiodobenzoyl)oxypentanimidate |
| SMILES | CS(=O)(=O)/N=C(/[O-])CCCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H14I3NO5S/c1-23(20,21)17-11(18)4-2-3-5-22-13(19)9-6-8(14)7-10(15)12(9)16/h6-7H,2-5H2,1H3,(H,17,18)/p-1 |
| InChIKey | DBVPPHPOBAJZCU-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 95.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.03 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|