C10H9I3NO3S- — CID 153287238
(1E)-N-methylsulfonyl-3-(2,3,5-triiodophenyl)propanimidate (PubChem CID 153287238) has the molecular formula C10H9I3NO3S- and a molecular weight of 603.97 g/mol. Its IUPAC name is (1E)-N-methylsulfonyl-3-(2,3,5-triiodophenyl)propanimidate.
| Compound Name | (1E)-N-methylsulfonyl-3-(2,3,5-triiodophenyl)propanimidate |
|---|---|
| PubChem CID | 153287238 |
| Molecular Formula | C10H9I3NO3S- |
| Molecular Weight | 603.97 g/mol |
| Exact Mass | 603.74 |
| IUPAC Name | (1E)-N-methylsulfonyl-3-(2,3,5-triiodophenyl)propanimidate |
| SMILES | CS(=O)(=O)/N=C(/[O-])CCc1cc(I)cc(I)c1I |
| InChI | InChI=1S/C10H10I3NO3S/c1-18(16,17)14-9(15)3-2-6-4-7(11)5-8(12)10(6)13/h4-5H,2-3H2,1H3,(H,14,15)/p-1 |
| InChIKey | IGIMWYNNJDVPKP-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.97 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|