C14H13I3NO3S- — CID 153287299
(1Z)-N-(2-bicyclo[2.2.1]heptanylsulfonyl)-2,3,5-triiodobenzenecarboximidate (PubChem CID 153287299) has the molecular formula C14H13I3NO3S- and a molecular weight of 656.04 g/mol. Its IUPAC name is (1Z)-N-(2-bicyclo[2.2.1]heptanylsulfonyl)-2,3,5-triiodobenzenecarboximidate.
| Compound Name | (1Z)-N-(2-bicyclo[2.2.1]heptanylsulfonyl)-2,3,5-triiodobenzenecarboximidate |
|---|---|
| PubChem CID | 153287299 |
| Molecular Formula | C14H13I3NO3S- |
| Molecular Weight | 656.04 g/mol |
| Exact Mass | 655.78 |
| IUPAC Name | (1Z)-N-(2-bicyclo[2.2.1]heptanylsulfonyl)-2,3,5-triiodobenzenecarboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])c1cc(I)cc(I)c1I)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H14I3NO3S/c15-9-5-10(13(17)11(16)6-9)14(19)18-22(20,21)12-4-7-1-2-8(12)3-7/h5-8,12H,1-4H2,(H,18,19)/p-1 |
| InChIKey | WAXNBQGLUNCTSB-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|