C13H16ClNO2S — CID 114247052
4-(2-bicyclo[2.2.1]heptanylsulfonyl)-2-chloroaniline (PubChem CID 114247052) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylsulfonyl)-2-chloroaniline.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylsulfonyl)-2-chloroaniline |
|---|---|
| PubChem CID | 114247052 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylsulfonyl)-2-chloroaniline |
| SMILES | Nc1ccc(S(=O)(=O)C2CC3CCC2C3)cc1Cl |
| InChI | InChI=1S/C13H16ClNO2S/c14-11-7-10(3-4-12(11)15)18(16,17)13-6-8-1-2-9(13)5-8/h3-4,7-9,13H,1-2,5-6,15H2 |
| InChIKey | PYJQQUPAWNMUIO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|