C7H3I2KO3 — CID 23716296
potassium 2-hydroxy-3,5-diiodobenzoate (PubChem CID 23716296) has the molecular formula C7H3I2KO3 and a molecular weight of 428.00 g/mol. Its IUPAC name is potassium 2-hydroxy-3,5-diiodobenzoate.
| Compound Name | potassium 2-hydroxy-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 23716296 |
| Molecular Formula | C7H3I2KO3 |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.78 |
| IUPAC Name | potassium 2-hydroxy-3,5-diiodobenzoate |
| SMILES | O=C([O-])c1cc(I)cc(I)c1O.[K+] |
| InChI | InChI=1S/C7H4I2O3.K/c8-3-1-4(7(11)12)6(10)5(9)2-3;/h1-2,10H,(H,11,12);/q;+1/p-1 |
| InChIKey | SNHIVWOGVZUVLO-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|