C8H6I2O3 — CID 3695482
methyl 2-hydroxy-3,5-diiodobenzoate (PubChem CID 3695482) has the molecular formula C8H6I2O3 and a molecular weight of 403.94 g/mol. Its IUPAC name is methyl 2-hydroxy-3,5-diiodobenzoate.
| Compound Name | methyl 2-hydroxy-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 3695482 |
| Molecular Formula | C8H6I2O3 |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.84 |
| IUPAC Name | methyl 2-hydroxy-3,5-diiodobenzoate |
| SMILES | COC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C8H6I2O3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,1H3 |
| InChIKey | GNPLRLCRSBLCKZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|