C14H18O5 — CID 170871811
dimethyl 5-tert-butyl-2-hydroxybenzene-1,3-dicarboxylate (PubChem CID 170871811) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is dimethyl 5-tert-butyl-2-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-tert-butyl-2-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 170871811 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | dimethyl 5-tert-butyl-2-hydroxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(C)(C)C)cc(C(=O)OC)c1O |
| InChI | InChI=1S/C14H18O5/c1-14(2,3)8-6-9(12(16)18-4)11(15)10(7-8)13(17)19-5/h6-7,15H,1-5H3 |
| InChIKey | MOZPDCOFQADRID-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |